C27H20N2O4 — CID 2865430
5-[[4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2865430) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-[[4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2865430 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[[4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccccc1C1C(C=C2C(=O)NC(=O)NC2=O)=C(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C27H20N2O4/c1-16-9-5-6-12-18(16)23-19-13-7-8-14-22(19)33-24(17-10-3-2-4-11-17)20(23)15-21-25(30)28-27(32)29-26(21)31/h2-15,23H,1H3,(H2,28,29,30,31,32) |
| InChIKey | MAYYSCSVTBKIDJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|