C19H31NO5 — CID 2865538
N-tert-butyl-4-(2,3,5-trimethylphenoxy)butan-1-amine;oxalic acid (PubChem CID 2865538) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-tert-butyl-4-(2,3,5-trimethylphenoxy)butan-1-amine;oxalic acid.
| Compound Name | N-tert-butyl-4-(2,3,5-trimethylphenoxy)butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2865538 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-tert-butyl-4-(2,3,5-trimethylphenoxy)butan-1-amine;oxalic acid |
| SMILES | Cc1cc(C)c(C)c(OCCCCNC(C)(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H29NO.C2H2O4/c1-13-11-14(2)15(3)16(12-13)19-10-8-7-9-18-17(4,5)6;3-1(4)2(5)6/h11-12,18H,7-10H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | DINHQSRIVYZLSS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|