About 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine
2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine (PubChem CID 2865629) has the molecular formula C17H23N3S
and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine |
| PubChem CID | 2865629 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine |
| SMILES | CCC1SC(N2CCCCCC2)=NN=C1c1ccccc1 |
| InChI | InChI=1S/C17H23N3S/c1-2-15-16(14-10-6-5-7-11-14)18-19-17(21-15)20-12-8-3-4-9-13-20/h5-7,10-11,15H,2-4,8-9,12-13H2,1H3 |
| InChIKey | ZCJGPMSGQGJEMM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine?
The IUPAC name of 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine (CID 2865629) is 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine.
What is the SMILES notation for 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine?
The canonical SMILES for 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine is CCC1SC(N2CCCCCC2)=NN=C1c1ccccc1.
What is the InChIKey of 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine?
The InChIKey is ZCJGPMSGQGJEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3S/c1-2-15-16(14-10-6-5-7-11-14)18-19-17(21-15)20-12-8-3-4-9-13-20/h5-7,10-11,15H,2-4,8-9,12-13H2,1H3.
What are the key properties of 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine?
2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine has a molecular weight of 301.46 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)-6-ethyl-5-phenyl-6H-1,3,4-thiadiazine is sourced from PubChem (CID 2865629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).