C23H25NO4S3 — CID 2865727
diethyl 5',5',9'-trimethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate (PubChem CID 2865727) has the molecular formula C23H25NO4S3 and a molecular weight of 475.66 g/mol. Its IUPAC name is diethyl 5',5',9'-trimethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate.
| Compound Name | diethyl 5',5',9'-trimethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate |
|---|---|
| PubChem CID | 2865727 |
| Molecular Formula | C23H25NO4S3 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | diethyl 5',5',9'-trimethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate |
| SMILES | CCOC(=O)C1=CC2(SC=C(C(=O)OCC)S2)C2=C(S1)C(C)(C)Nc1ccc(C)cc12 |
| InChI | InChI=1S/C23H25NO4S3/c1-6-27-20(25)16-11-23(29-12-17(31-23)21(26)28-7-2)18-14-10-13(3)8-9-15(14)24-22(4,5)19(18)30-16/h8-12,24H,6-7H2,1-5H3 |
| InChIKey | FSIQDCLVHQRPMX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |