C24H27NO4S3 — CID 2865805
diethyl 5',5',8',9'-tetramethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate (PubChem CID 2865805) has the molecular formula C24H27NO4S3 and a molecular weight of 489.68 g/mol. Its IUPAC name is diethyl 5',5',8',9'-tetramethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate.
| Compound Name | diethyl 5',5',8',9'-tetramethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate |
|---|---|
| PubChem CID | 2865805 |
| Molecular Formula | C24H27NO4S3 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | diethyl 5',5',8',9'-tetramethylspiro[1,3-dithiole-2,1'-6H-thiopyrano[2,3-c]quinoline]-3',4-dicarboxylate |
| SMILES | CCOC(=O)C1=CC2(SC=C(C(=O)OCC)S2)C2=C(S1)C(C)(C)Nc1cc(C)c(C)cc12 |
| InChI | InChI=1S/C24H27NO4S3/c1-7-28-21(26)17-11-24(30-12-18(32-24)22(27)29-8-2)19-15-9-13(3)14(4)10-16(15)25-23(5,6)20(19)31-17/h9-12,25H,7-8H2,1-6H3 |
| InChIKey | XRSCIIPLQYSXNX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |