C18H32ClNO — CID 2866024
N-[3-(2-tert-butyl-4-methylphenoxy)propyl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 2866024) has the molecular formula C18H32ClNO and a molecular weight of 313.91 g/mol. Its IUPAC name is N-[3-(2-tert-butyl-4-methylphenoxy)propyl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | N-[3-(2-tert-butyl-4-methylphenoxy)propyl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 2866024 |
| Molecular Formula | C18H32ClNO |
| Molecular Weight | 313.91 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[3-(2-tert-butyl-4-methylphenoxy)propyl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | Cc1ccc(OCCCNC(C)(C)C)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C18H31NO.ClH/c1-14-9-10-16(15(13-14)17(2,3)4)20-12-8-11-19-18(5,6)7;/h9-10,13,19H,8,11-12H2,1-7H3;1H |
| InChIKey | PQMBTKVULJFFRR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|