C9H17NO — CID 28660510
cis-(1S,2R)-2-(prop-2-enylamino)cyclohexan-1-ol (PubChem CID 28660510) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is cis-(1S,2R)-2-(prop-2-enylamino)cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-(prop-2-enylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 28660510 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | cis-(1S,2R)-2-(prop-2-enylamino)cyclohexan-1-ol |
| SMILES | C=CCN[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C9H17NO/c1-2-7-10-8-5-3-4-6-9(8)11/h2,8-11H,1,3-7H2/t8-,9+/m1/s1 |
| InChIKey | OTIPKNWIQIQHLA-BDAKNGLRSA-N |
| XLogP | 1.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|