About 5-nitro-2-phenylindazole
5-nitro-2-phenylindazole (PubChem CID 2866090) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is 5-nitro-2-phenylindazole.
Molecular Properties
| Compound Name | 5-nitro-2-phenylindazole |
| PubChem CID | 2866090 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 5-nitro-2-phenylindazole |
| SMILES | O=[N+]([O-])c1ccc2nn(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C13H9N3O2/c17-16(18)12-6-7-13-10(8-12)9-15(14-13)11-4-2-1-3-5-11/h1-9H |
| InChIKey | YOEXSNSVJTVIRI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-phenylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-phenylindazole?
The IUPAC name of 5-nitro-2-phenylindazole (CID 2866090) is 5-nitro-2-phenylindazole.
What is the SMILES notation for 5-nitro-2-phenylindazole?
The canonical SMILES for 5-nitro-2-phenylindazole is O=[N+]([O-])c1ccc2nn(-c3ccccc3)cc2c1.
What is the InChIKey of 5-nitro-2-phenylindazole?
The InChIKey is YOEXSNSVJTVIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-16(18)12-6-7-13-10(8-12)9-15(14-13)11-4-2-1-3-5-11/h1-9H.
What are the key properties of 5-nitro-2-phenylindazole?
5-nitro-2-phenylindazole has a molecular weight of 239.23 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-phenylindazole is sourced from PubChem (CID 2866090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).