C17H19Cl2NO2 — CID 2866138
4-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)morpholine (PubChem CID 2866138) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 4-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)morpholine.
| Compound Name | 4-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)morpholine |
|---|---|
| PubChem CID | 2866138 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)morpholine |
| SMILES | Clc1cc(Cl)c2c(c1)C=C1CCCCC1(N1CCOCC1)O2 |
| InChI | InChI=1S/C17H19Cl2NO2/c18-14-10-12-9-13-3-1-2-4-17(13,20-5-7-21-8-6-20)22-16(12)15(19)11-14/h9-11H,1-8H2 |
| InChIKey | COSRWYZDVXYLOJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |