C8H13N — CID 28665047
(3aS,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindole (PubChem CID 28665047) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (3aS,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindole.
| Compound Name | (3aS,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 28665047 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (3aS,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindole |
| SMILES | C1=CC[C@@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C8H13N/c1-2-4-8-6-9-5-7(8)3-1/h1-2,7-9H,3-6H2/t7-,8-/m1/s1 |
| InChIKey | HWZHYUCYEYJQTE-HTQZYQBOSA-N |
| XLogP | 1.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|