C19H15ClINO3 — CID 28668065
2-chloro-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-5-iodobenzamide (PubChem CID 28668065) has the molecular formula C19H15ClINO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is 2-chloro-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 28668065 |
| Molecular Formula | C19H15ClINO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 2-chloro-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-5-iodobenzamide |
| SMILES | Cc1ccc(-c2ccc(CO)o2)cc1NC(=O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C19H15ClINO3/c1-11-2-3-12(18-7-5-14(10-23)25-18)8-17(11)22-19(24)15-9-13(21)4-6-16(15)20/h2-9,23H,10H2,1H3,(H,22,24) |
| InChIKey | NYZRAPHUQMSCRX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|