C14H17NOS — CID 28668693
(1R)-1-(3-methoxyphenyl)-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 28668693) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 28668693 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | COc1cccc([C@@H](C)NCc2cccs2)c1 |
| InChI | InChI=1S/C14H17NOS/c1-11(15-10-14-7-4-8-17-14)12-5-3-6-13(9-12)16-2/h3-9,11,15H,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | ONUAAVVQBCAROY-LLVKDONJSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |