C11H18N2O — CID 2866904
4-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-quinazolin-2-one (PubChem CID 2866904) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-quinazolin-2-one.
| Compound Name | 4-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 2866904 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-quinazolin-2-one |
| SMILES | CC(C)C1=C2CCCCC2NC(=O)N1 |
| InChI | InChI=1S/C11H18N2O/c1-7(2)10-8-5-3-4-6-9(8)12-11(14)13-10/h7,9H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | KOLDAQYFFQGZJS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |