C10H7I2N3O2 — CID 2867079
2,4-diiodo-6-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol (PubChem CID 2867079) has the molecular formula C10H7I2N3O2 and a molecular weight of 454.99 g/mol. Its IUPAC name is 2,4-diiodo-6-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol.
| Compound Name | 2,4-diiodo-6-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 2867079 |
| Molecular Formula | C10H7I2N3O2 |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | 2,4-diiodo-6-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
| SMILES | Cc1nonc1/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C10H7I2N3O2/c1-5-10(15-17-14-5)13-4-6-2-7(11)3-8(12)9(6)16/h2-4,16H,1H3/b13-4+ |
| InChIKey | JAUPBQPGQMPEAD-YIXHJXPBSA-N |
| XLogP | 3.04 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|