C15H10Cl2N2O5 — CID 28671342
2,4-dichloro-5-[(4-methyl-3-nitrobenzoyl)amino]benzoic acid (PubChem CID 28671342) has the molecular formula C15H10Cl2N2O5 and a molecular weight of 369.16 g/mol. Its IUPAC name is 2,4-dichloro-5-[(4-methyl-3-nitrobenzoyl)amino]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(4-methyl-3-nitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 28671342 |
| Molecular Formula | C15H10Cl2N2O5 |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2,4-dichloro-5-[(4-methyl-3-nitrobenzoyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(=O)O)c(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Cl2N2O5/c1-7-2-3-8(4-13(7)19(23)24)14(20)18-12-5-9(15(21)22)10(16)6-11(12)17/h2-6H,1H3,(H,18,20)(H,21,22) |
| InChIKey | KERLXNVHZJMLHL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|