About 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide (PubChem CID 2867227) has the molecular formula C11H10ClN3O2S
and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide |
| PubChem CID | 2867227 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide |
| SMILES | NC1=NC(=O)C(CC(=O)Nc2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C11H10ClN3O2S/c12-6-1-3-7(4-2-6)14-9(16)5-8-10(17)15-11(13)18-8/h1-4,8H,5H2,(H,14,16)(H2,13,15,17) |
| InChIKey | GYFPHRSBRZDSET-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide?
The IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide (CID 2867227) is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide.
What is the SMILES notation for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide?
The canonical SMILES for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide is NC1=NC(=O)C(CC(=O)Nc2ccc(Cl)cc2)S1.
What is the InChIKey of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide?
The InChIKey is GYFPHRSBRZDSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O2S/c12-6-1-3-7(4-2-6)14-9(16)5-8-10(17)15-11(13)18-8/h1-4,8H,5H2,(H,14,16)(H2,13,15,17).
What are the key properties of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide?
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide has a molecular weight of 283.74 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-(4-chlorophenyl)acetamide is sourced from PubChem (CID 2867227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).