2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid

C17H15Cl2NO4 — CID 28672335

IUPAC2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid
SMILESCC(C)Oc1cccc(C(=O)Nc2cc(C(=O)O)c(Cl)cc2Cl)c1
InChIInChI=1S/C17H15Cl2NO4/c1-9(2)24-11-5-3-4-10(6-11)16(21)20-15-7-12(17(22)23)13(18)8-14(15)19/h3-9H,1-2H3,(H,20,21)(H,22,23)
InChIKeyVLHQGCDBKNZMFT-UHFFFAOYSA-N
MW368.22 g/mol
LogP4.73
Rot. Bonds5

About 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid

2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid (PubChem CID 28672335) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid
PubChem CID28672335
Molecular FormulaC17H15Cl2NO4
Molecular Weight368.22 g/mol
Exact Mass367.04
IUPAC Name2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid
SMILESCC(C)Oc1cccc(C(=O)Nc2cc(C(=O)O)c(Cl)cc2Cl)c1
InChIInChI=1S/C17H15Cl2NO4/c1-9(2)24-11-5-3-4-10(6-11)16(21)20-15-7-12(17(22)23)13(18)8-14(15)19/h3-9H,1-2H3,(H,20,21)(H,22,23)
InChIKeyVLHQGCDBKNZMFT-UHFFFAOYSA-N
XLogP4.73
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.22
LogP ≤ 54.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid?
The IUPAC name of 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid (CID 28672335) is 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid.
What is the SMILES notation for 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid?
The canonical SMILES for 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid is CC(C)Oc1cccc(C(=O)Nc2cc(C(=O)O)c(Cl)cc2Cl)c1.
What is the InChIKey of 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid?
The InChIKey is VLHQGCDBKNZMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO4/c1-9(2)24-11-5-3-4-10(6-11)16(21)20-15-7-12(17(22)23)13(18)8-14(15)19/h3-9H,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid?
2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid has a molecular weight of 368.22 g/mol, XLogP of 4.73, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-[(3-propan-2-yloxybenzoyl)amino]benzoic acid is sourced from PubChem (CID 28672335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).