C16H25ClN2O — CID 28675051
4-chloro-2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol (PubChem CID 28675051) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 4-chloro-2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 28675051 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-chloro-2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol |
| SMILES | CC1(C)CC(NCc2cc(Cl)ccc2O)CC(C)(C)N1 |
| InChI | InChI=1S/C16H25ClN2O/c1-15(2)8-13(9-16(3,4)19-15)18-10-11-7-12(17)5-6-14(11)20/h5-7,13,18-20H,8-10H2,1-4H3 |
| InChIKey | BMQVBZBBRXBFPY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|