About 1-pyrazin-2-ylazepane
1-pyrazin-2-ylazepane (PubChem CID 2867732) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-pyrazin-2-ylazepane.
Molecular Properties
| Compound Name | 1-pyrazin-2-ylazepane |
| PubChem CID | 2867732 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-pyrazin-2-ylazepane |
| SMILES | c1cnc(N2CCCCCC2)cn1 |
| InChI | InChI=1S/C10H15N3/c1-2-4-8-13(7-3-1)10-9-11-5-6-12-10/h5-6,9H,1-4,7-8H2 |
| InChIKey | ALZRYURNSVYEKA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyrazin-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylazepane?
The IUPAC name of 1-pyrazin-2-ylazepane (CID 2867732) is 1-pyrazin-2-ylazepane.
What is the SMILES notation for 1-pyrazin-2-ylazepane?
The canonical SMILES for 1-pyrazin-2-ylazepane is c1cnc(N2CCCCCC2)cn1.
What is the InChIKey of 1-pyrazin-2-ylazepane?
The InChIKey is ALZRYURNSVYEKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-2-4-8-13(7-3-1)10-9-11-5-6-12-10/h5-6,9H,1-4,7-8H2.
What are the key properties of 1-pyrazin-2-ylazepane?
1-pyrazin-2-ylazepane has a molecular weight of 177.25 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylazepane is sourced from PubChem (CID 2867732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).