C19H26N4O2 — CID 2867802
N-(1-ethylpiperidin-4-yl)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 2867802) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-(1-ethylpiperidin-4-yl)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 2867802 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CCN1CCC(NC2CCCc3c2[nH]c2ccc([N+](=O)[O-])cc32)CC1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-22-10-8-13(9-11-22)20-18-5-3-4-15-16-12-14(23(24)25)6-7-17(16)21-19(15)18/h6-7,12-13,18,20-21H,2-5,8-11H2,1H3 |
| InChIKey | PWBFNNRPJWBPEF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|