C12H22O2 — CID 28679
4,4,5,5-tetramethyloctane-2,7-dione (PubChem CID 28679) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyloctane-2,7-dione.
| Compound Name | 4,4,5,5-tetramethyloctane-2,7-dione |
|---|---|
| PubChem CID | 28679 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 4,4,5,5-tetramethyloctane-2,7-dione |
| SMILES | CC(=O)CC(C)(C)C(C)(C)CC(C)=O |
| InChI | InChI=1S/C12H22O2/c1-9(13)7-11(3,4)12(5,6)8-10(2)14/h7-8H2,1-6H3 |
| InChIKey | GTRYXHORFPEEMD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |