C24H26O12 — CID 2868306
diethyl 2-[1-(1,3-diethoxy-1,3-dioxopropan-2-yl)-3,7-dioxo-1,5-dihydrofuro[3,4-f][2]benzofuran-5-yl]propanedioate (PubChem CID 2868306) has the molecular formula C24H26O12 and a molecular weight of 506.46 g/mol. Its IUPAC name is diethyl 2-[1-(1,3-diethoxy-1,3-dioxopropan-2-yl)-3,7-dioxo-1,5-dihydrofuro[3,4-f][2]benzofuran-5-yl]propanedioate.
| Compound Name | diethyl 2-[1-(1,3-diethoxy-1,3-dioxopropan-2-yl)-3,7-dioxo-1,5-dihydrofuro[3,4-f][2]benzofuran-5-yl]propanedioate |
|---|---|
| PubChem CID | 2868306 |
| Molecular Formula | C24H26O12 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | diethyl 2-[1-(1,3-diethoxy-1,3-dioxopropan-2-yl)-3,7-dioxo-1,5-dihydrofuro[3,4-f][2]benzofuran-5-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1OC(=O)c2cc3c(cc21)C(=O)OC3C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H26O12/c1-5-31-21(27)15(22(28)32-6-2)17-11-9-14-12(10-13(11)19(25)35-17)18(36-20(14)26)16(23(29)33-7-3)24(30)34-8-4/h9-10,15-18H,5-8H2,1-4H3 |
| InChIKey | PBYZHCQDCGKBJY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|