About 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride
1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride (PubChem CID 2868406) has the molecular formula C14H20ClNO3
and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride |
| PubChem CID | 2868406 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride |
| SMILES | CCN(CC)CCC(=O)c1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C14H19NO3.ClH/c1-3-15(4-2)8-7-12(16)11-5-6-13-14(9-11)18-10-17-13;/h5-6,9H,3-4,7-8,10H2,1-2H3;1H |
| InChIKey | IAADMZGSCYTXBP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride (CID 2868406) is 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride is CCN(CC)CCC(=O)c1ccc2c(c1)OCO2.Cl.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride?
The InChIKey is IAADMZGSCYTXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.ClH/c1-3-15(4-2)8-7-12(16)11-5-6-13-14(9-11)18-10-17-13;/h5-6,9H,3-4,7-8,10H2,1-2H3;1H.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride?
1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride has a molecular weight of 285.77 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-3-(diethylamino)propan-1-one;hydrochloride is sourced from PubChem (CID 2868406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).