C14H16N4O — CID 2868471
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-3-(2-methoxyphenyl)prop-2-en-1-imine (PubChem CID 2868471) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-3-(2-methoxyphenyl)prop-2-en-1-imine.
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-3-(2-methoxyphenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 2868471 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-3-(2-methoxyphenyl)prop-2-en-1-imine |
| SMILES | COc1ccccc1C=CC=Nn1c(C)nnc1C |
| InChI | InChI=1S/C14H16N4O/c1-11-16-17-12(2)18(11)15-10-6-8-13-7-4-5-9-14(13)19-3/h4-10H,1-3H3 |
| InChIKey | LXQFYNXTJMCJFF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|