C25H24F3N3O4 — CID 28685027
methyl 7-oxo-9-(pyridin-2-ylmethoxy)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 28685027) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is methyl 7-oxo-9-(pyridin-2-ylmethoxy)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 7-oxo-9-(pyridin-2-ylmethoxy)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 28685027 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | methyl 7-oxo-9-(pyridin-2-ylmethoxy)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCc2ccccn2)cc(=O)n2c1CCN(Cc1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C25H24F3N3O4/c1-34-24(33)23-20-8-10-30(15-17-5-4-6-18(13-17)25(26,27)28)11-12-31(20)22(32)14-21(23)35-16-19-7-2-3-9-29-19/h2-7,9,13-14H,8,10-12,15-16H2,1H3 |
| InChIKey | CCOIOYDOXCTQAP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |