About 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole
3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole (PubChem CID 2868649) has the molecular formula C22H25N5
and a molecular weight of 359.48 g/mol. Its IUPAC name is 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole |
| PubChem CID | 2868649 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole |
| SMILES | CN1CCN(CCn2c(-c3ccccc3)cn3c4ccccc4nc23)CC1 |
| InChI | InChI=1S/C22H25N5/c1-24-11-13-25(14-12-24)15-16-26-21(18-7-3-2-4-8-18)17-27-20-10-6-5-9-19(20)23-22(26)27/h2-10,17H,11-16H2,1H3 |
| InChIKey | PAGOAMDCIBIXCH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 28.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole?
The IUPAC name of 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole (CID 2868649) is 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole.
What is the SMILES notation for 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole?
The canonical SMILES for 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole is CN1CCN(CCn2c(-c3ccccc3)cn3c4ccccc4nc23)CC1.
What is the InChIKey of 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole?
The InChIKey is PAGOAMDCIBIXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5/c1-24-11-13-25(14-12-24)15-16-26-21(18-7-3-2-4-8-18)17-27-20-10-6-5-9-19(20)23-22(26)27/h2-10,17H,11-16H2,1H3.
What are the key properties of 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole?
3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole has a molecular weight of 359.48 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-methylpiperazin-1-yl)ethyl]-2-phenylimidazo[1,2-a]benzimidazole is sourced from PubChem (CID 2868649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).