C27H23F4NO2 — CID 2868762
2,2-dimethyl-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 2868762) has the molecular formula C27H23F4NO2 and a molecular weight of 469.48 g/mol. Its IUPAC name is 2,2-dimethyl-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | 2,2-dimethyl-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 2868762 |
| Molecular Formula | C27H23F4NO2 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2,2-dimethyl-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)c1c(ccc3ccccc13)NC2c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H23F4NO2/c1-26(2)13-19-22-18-9-4-3-6-15(18)10-11-20(22)32-24(23(19)21(33)14-26)16-7-5-8-17(12-16)34-27(30,31)25(28)29/h3-12,24-25,32H,13-14H2,1-2H3 |
| InChIKey | DCEKCWYBQDWVJF-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|