C15H16N2O3 — CID 2868934
7-benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione (PubChem CID 2868934) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 7-benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione.
| Compound Name | 7-benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione |
|---|---|
| PubChem CID | 2868934 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 7-benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione |
| SMILES | CN1C(=O)CC2(CC(=O)N(Cc3ccccc3)C2)C1=O |
| InChI | InChI=1S/C15H16N2O3/c1-16-12(18)7-15(14(16)20)8-13(19)17(10-15)9-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | BJXWKDYLCKBAMS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|