C12H16N2O — CID 28689695
2-(3-aminophenyl)-N-(cyclopropylmethyl)acetamide (PubChem CID 28689695) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(cyclopropylmethyl)acetamide.
| Compound Name | 2-(3-aminophenyl)-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 28689695 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(3-aminophenyl)-N-(cyclopropylmethyl)acetamide |
| SMILES | Nc1cccc(CC(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C12H16N2O/c13-11-3-1-2-10(6-11)7-12(15)14-8-9-4-5-9/h1-3,6,9H,4-5,7-8,13H2,(H,14,15) |
| InChIKey | PADQTHCJMFGKAQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|