C22H26N2O5S — CID 2868971
3-(2-anilino-1,3-thiazol-4-yl)-3-methyl-8-(2-methylpropoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 2868971) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(2-anilino-1,3-thiazol-4-yl)-3-methyl-8-(2-methylpropoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | 3-(2-anilino-1,3-thiazol-4-yl)-3-methyl-8-(2-methylpropoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 2868971 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-(2-anilino-1,3-thiazol-4-yl)-3-methyl-8-(2-methylpropoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | CC(C)COCC1CC2(CC(C)(c3csc(Nc4ccccc4)n3)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C22H26N2O5S/c1-14(2)10-27-11-16-9-22(18(25)28-16)13-21(3,29-19(22)26)17-12-30-20(24-17)23-15-7-5-4-6-8-15/h4-8,12,14,16H,9-11,13H2,1-3H3,(H,23,24) |
| InChIKey | SBIIPIYVHGZREK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|