About cyclopropylmethyl 2-amino-4-chlorobenzoate
cyclopropylmethyl 2-amino-4-chlorobenzoate (PubChem CID 28690164) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is cyclopropylmethyl 2-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | cyclopropylmethyl 2-amino-4-chlorobenzoate |
| PubChem CID | 28690164 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | cyclopropylmethyl 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCC1CC1 |
| InChI | InChI=1S/C11H12ClNO2/c12-8-3-4-9(10(13)5-8)11(14)15-6-7-1-2-7/h3-5,7H,1-2,6,13H2 |
| InChIKey | KFEGMHGOGBRVIM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethyl 2-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 2-amino-4-chlorobenzoate?
The IUPAC name of cyclopropylmethyl 2-amino-4-chlorobenzoate (CID 28690164) is cyclopropylmethyl 2-amino-4-chlorobenzoate.
What is the SMILES notation for cyclopropylmethyl 2-amino-4-chlorobenzoate?
The canonical SMILES for cyclopropylmethyl 2-amino-4-chlorobenzoate is Nc1cc(Cl)ccc1C(=O)OCC1CC1.
What is the InChIKey of cyclopropylmethyl 2-amino-4-chlorobenzoate?
The InChIKey is KFEGMHGOGBRVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c12-8-3-4-9(10(13)5-8)11(14)15-6-7-1-2-7/h3-5,7H,1-2,6,13H2.
What are the key properties of cyclopropylmethyl 2-amino-4-chlorobenzoate?
cyclopropylmethyl 2-amino-4-chlorobenzoate has a molecular weight of 225.68 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 2-amino-4-chlorobenzoate is sourced from PubChem (CID 28690164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).