About (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide
(2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide (PubChem CID 28691113) has the molecular formula C3H7F3N4O2
and a molecular weight of 188.11 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide.
Molecular Properties
| Compound Name | (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide |
| PubChem CID | 28691113 |
| Molecular Formula | C3H7F3N4O2 |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide |
| SMILES | NNC(=O)[C@@](O)(NN)C(F)(F)F |
| InChI | InChI=1S/C3H7F3N4O2/c4-3(5,6)2(12,10-8)1(11)9-7/h10,12H,7-8H2,(H,9,11)/t2-/m0/s1 |
| InChIKey | TXCWKGMKKWOSJD-REOHCLBHSA-N |
| XLogP | -2.31 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide?
The IUPAC name of (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide (CID 28691113) is (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide.
What is the SMILES notation for (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide?
The canonical SMILES for (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide is NNC(=O)[C@@](O)(NN)C(F)(F)F.
What is the InChIKey of (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide?
The InChIKey is TXCWKGMKKWOSJD-REOHCLBHSA-N. The full InChI is InChI=1S/C3H7F3N4O2/c4-3(5,6)2(12,10-8)1(11)9-7/h10,12H,7-8H2,(H,9,11)/t2-/m0/s1.
What are the key properties of (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide?
(2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide has a molecular weight of 188.11 g/mol, XLogP of -2.31, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3,3-trifluoro-2-hydrazinyl-2-hydroxypropanehydrazide is sourced from PubChem (CID 28691113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).