About 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine
4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine (PubChem CID 2869201) has the molecular formula C16H18N6O6
and a molecular weight of 390.36 g/mol. Its IUPAC name is 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine |
| PubChem CID | 2869201 |
| Molecular Formula | C16H18N6O6 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine |
| SMILES | O=[N+]([O-])c1cc2nc(N3CCOCC3)c(N3CCOCC3)nc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N6O6/c23-21(24)13-9-11-12(10-14(13)22(25)26)18-16(20-3-7-28-8-4-20)15(17-11)19-1-5-27-6-2-19/h9-10H,1-8H2 |
| InChIKey | IOPJJEXDYBXZJZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 137.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine?
The IUPAC name of 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine (CID 2869201) is 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine.
What is the SMILES notation for 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine?
The canonical SMILES for 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine is O=[N+]([O-])c1cc2nc(N3CCOCC3)c(N3CCOCC3)nc2cc1[N+](=O)[O-].
What is the InChIKey of 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine?
The InChIKey is IOPJJEXDYBXZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O6/c23-21(24)13-9-11-12(10-14(13)22(25)26)18-16(20-3-7-28-8-4-20)15(17-11)19-1-5-27-6-2-19/h9-10H,1-8H2.
What are the key properties of 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine?
4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine has a molecular weight of 390.36 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-morpholin-4-yl-6,7-dinitroquinoxalin-2-yl)morpholine is sourced from PubChem (CID 2869201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).