C14H12ClF3N2O2 — CID 2869286
3-chloro-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide (PubChem CID 2869286) has the molecular formula C14H12ClF3N2O2 and a molecular weight of 332.71 g/mol. Its IUPAC name is 3-chloro-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide.
| Compound Name | 3-chloro-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 2869286 |
| Molecular Formula | C14H12ClF3N2O2 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-chloro-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]benzohydrazide |
| SMILES | O=C(NNC1=C(C(=O)C(F)(F)F)CCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12ClF3N2O2/c15-9-4-1-3-8(7-9)13(22)20-19-11-6-2-5-10(11)12(21)14(16,17)18/h1,3-4,7,19H,2,5-6H2,(H,20,22) |
| InChIKey | KERYBVXPXPANOI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|