C7H7N3OS — CID 28692909
5-(2-methylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 28692909) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-(2-methylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-methylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 28692909 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-(2-methylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1occc1-c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C7H7N3OS/c1-4-5(2-3-11-4)6-8-7(12)10-9-6/h2-3H,1H3,(H2,8,9,10,12) |
| InChIKey | VTEADNUNCRZFEL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|