About 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid
2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 28693138) has the molecular formula C13H14N2O3S
and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| PubChem CID | 28693138 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(CCCc2ccccc2)o1 |
| InChI | InChI=1S/C13H14N2O3S/c16-12(17)9-19-13-15-14-11(18-13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,16,17) |
| InChIKey | FSEMSZBMJBCVEV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The IUPAC name of 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (CID 28693138) is 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
What is the SMILES notation for 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The canonical SMILES for 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid is O=C(O)CSc1nnc(CCCc2ccccc2)o1.
What is the InChIKey of 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The InChIKey is FSEMSZBMJBCVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c16-12(17)9-19-13-15-14-11(18-13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,16,17).
What are the key properties of 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid has a molecular weight of 278.33 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid is sourced from PubChem (CID 28693138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).