C28H29NO5S — CID 28693893
2-O-benzyl 4-O-ethyl 3-methyl-5-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 28693893) has the molecular formula C28H29NO5S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-O-benzyl 4-O-ethyl 3-methyl-5-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-ethyl 3-methyl-5-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 28693893 |
| Molecular Formula | C28H29NO5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-O-benzyl 4-O-ethyl 3-methyl-5-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(C(C)C)cc2)sc(C(=O)OCc2ccccc2)c1C |
| InChI | InChI=1S/C28H29NO5S/c1-5-33-27(31)24-19(4)25(28(32)34-17-21-9-7-6-8-10-21)35-26(24)29-23(30)16-13-20-11-14-22(15-12-20)18(2)3/h6-16,18H,5,17H2,1-4H3,(H,29,30)/b16-13+ |
| InChIKey | OSCSSOIWBFFCQJ-DTQAZKPQSA-N |
| XLogP | 6.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|