About N-cyclohexyloxan-4-amine
N-cyclohexyloxan-4-amine (PubChem CID 28694222) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is N-cyclohexyloxan-4-amine.
Molecular Properties
| Compound Name | N-cyclohexyloxan-4-amine |
| PubChem CID | 28694222 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-cyclohexyloxan-4-amine |
| SMILES | C1CCC(NC2CCOCC2)CC1 |
| InChI | InChI=1S/C11H21NO/c1-2-4-10(5-3-1)12-11-6-8-13-9-7-11/h10-12H,1-9H2 |
| InChIKey | WGSUEWAHEXYQGS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyloxan-4-amine?
The IUPAC name of N-cyclohexyloxan-4-amine (CID 28694222) is N-cyclohexyloxan-4-amine.
What is the SMILES notation for N-cyclohexyloxan-4-amine?
The canonical SMILES for N-cyclohexyloxan-4-amine is C1CCC(NC2CCOCC2)CC1.
What is the InChIKey of N-cyclohexyloxan-4-amine?
The InChIKey is WGSUEWAHEXYQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-2-4-10(5-3-1)12-11-6-8-13-9-7-11/h10-12H,1-9H2.
What are the key properties of N-cyclohexyloxan-4-amine?
N-cyclohexyloxan-4-amine has a molecular weight of 183.29 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyloxan-4-amine is sourced from PubChem (CID 28694222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).