C21H26N6O — CID 28697267
2-[3-[[4-(4-cyclopropyltriazol-1-yl)piperidin-1-yl]methyl]indol-1-yl]acetamide (PubChem CID 28697267) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[3-[[4-(4-cyclopropyltriazol-1-yl)piperidin-1-yl]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[[4-(4-cyclopropyltriazol-1-yl)piperidin-1-yl]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 28697267 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[3-[[4-(4-cyclopropyltriazol-1-yl)piperidin-1-yl]methyl]indol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(CN2CCC(n3cc(C4CC4)nn3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H26N6O/c22-21(28)14-26-12-16(18-3-1-2-4-20(18)26)11-25-9-7-17(8-10-25)27-13-19(23-24-27)15-5-6-15/h1-4,12-13,15,17H,5-11,14H2,(H2,22,28) |
| InChIKey | WEGJSPXKKAGURR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |