C20H15NO2S — CID 2869854
10-thiophen-2-yl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 2869854) has the molecular formula C20H15NO2S and a molecular weight of 333.41 g/mol. Its IUPAC name is 10-thiophen-2-yl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | 10-thiophen-2-yl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 2869854 |
| Molecular Formula | C20H15NO2S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 10-thiophen-2-yl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | O=C1CCCC2=C1C(c1cccs1)C1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C20H15NO2S/c22-14-8-3-7-13-16(14)17(15-9-4-10-24-15)18-19(21-13)11-5-1-2-6-12(11)20(18)23/h1-2,4-6,9-10,17-18H,3,7-8H2 |
| InChIKey | VNQPVGLEMOTYAH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|