About 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine
2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 2869857) has the molecular formula C14H17N5
and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine |
| PubChem CID | 2869857 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | Cc1cc(C)nc(N/C(N)=N/Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H17N5/c1-10-8-11(2)18-14(17-10)19-13(15)16-9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | CVTHZPTYOUBYQM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The IUPAC name of 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine (CID 2869857) is 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine.
What is the SMILES notation for 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The canonical SMILES for 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine is Cc1cc(C)nc(N/C(N)=N/Cc2ccccc2)n1.
What is the InChIKey of 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The InChIKey is CVTHZPTYOUBYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5/c1-10-8-11(2)18-14(17-10)19-13(15)16-9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,15,16,17,18,19).
What are the key properties of 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine has a molecular weight of 255.33 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine is sourced from PubChem (CID 2869857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).