C24H26N2O4S — CID 28699337
(2S)-4-hydroxy-1-(3-morpholin-4-ylpropyl)-3-[(E)-3-phenylprop-2-enoyl]-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 28699337) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(3-morpholin-4-ylpropyl)-3-[(E)-3-phenylprop-2-enoyl]-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | (2S)-4-hydroxy-1-(3-morpholin-4-ylpropyl)-3-[(E)-3-phenylprop-2-enoyl]-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 28699337 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (2S)-4-hydroxy-1-(3-morpholin-4-ylpropyl)-3-[(E)-3-phenylprop-2-enoyl]-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(CCCN2CCOCC2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C24H26N2O4S/c27-19(10-9-18-6-2-1-3-7-18)21-22(20-8-4-17-31-20)26(24(29)23(21)28)12-5-11-25-13-15-30-16-14-25/h1-4,6-10,17,22,28H,5,11-16H2/b10-9+/t22-/m1/s1 |
| InChIKey | DYIHZWVQRQSWPO-DGSRBQDKSA-N |
| XLogP | 3.45 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|