methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate

C19H20N2O2 — CID 2870319

IUPACmethyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate
SMILESCOC(=O)CN1C(C)=Nc2ccc(C)cc2C1c1ccccc1
InChIInChI=1S/C19H20N2O2/c1-13-9-10-17-16(11-13)19(15-7-5-4-6-8-15)21(14(2)20-17)12-18(22)23-3/h4-11,19H,12H2,1-3H3
InChIKeyVWBYNUFXYIBZNI-UHFFFAOYSA-N
MW308.38 g/mol
LogP3.62
Rot. Bonds3

About methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate

methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate (PubChem CID 2870319) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate
PubChem CID2870319
Molecular FormulaC19H20N2O2
Molecular Weight308.38 g/mol
Exact Mass308.15
IUPAC Namemethyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate
SMILESCOC(=O)CN1C(C)=Nc2ccc(C)cc2C1c1ccccc1
InChIInChI=1S/C19H20N2O2/c1-13-9-10-17-16(11-13)19(15-7-5-4-6-8-15)21(14(2)20-17)12-18(22)23-3/h4-11,19H,12H2,1-3H3
InChIKeyVWBYNUFXYIBZNI-UHFFFAOYSA-N
XLogP3.62
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.38
LogP ≤ 53.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate?
The IUPAC name of methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate (CID 2870319) is methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate.
What is the SMILES notation for methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate?
The canonical SMILES for methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate is COC(=O)CN1C(C)=Nc2ccc(C)cc2C1c1ccccc1.
What is the InChIKey of methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate?
The InChIKey is VWBYNUFXYIBZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-13-9-10-17-16(11-13)19(15-7-5-4-6-8-15)21(14(2)20-17)12-18(22)23-3/h4-11,19H,12H2,1-3H3.
What are the key properties of methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate?
methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate has a molecular weight of 308.38 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-dimethyl-4-phenyl-4H-quinazolin-3-yl)acetate is sourced from PubChem (CID 2870319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).