C22H19BrN4O — CID 2870396
2-(6-bromo-2,4-diphenyl-4H-quinazolin-3-yl)acetohydrazide (PubChem CID 2870396) has the molecular formula C22H19BrN4O and a molecular weight of 435.33 g/mol. Its IUPAC name is 2-(6-bromo-2,4-diphenyl-4H-quinazolin-3-yl)acetohydrazide.
| Compound Name | 2-(6-bromo-2,4-diphenyl-4H-quinazolin-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 2870396 |
| Molecular Formula | C22H19BrN4O |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-(6-bromo-2,4-diphenyl-4H-quinazolin-3-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(c2ccccc2)=Nc2ccc(Br)cc2C1c1ccccc1 |
| InChI | InChI=1S/C22H19BrN4O/c23-17-11-12-19-18(13-17)21(15-7-3-1-4-8-15)27(14-20(28)26-24)22(25-19)16-9-5-2-6-10-16/h1-13,21H,14,24H2,(H,26,28) |
| InChIKey | AOJJIRRQWWRDIX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|