C16H18ClN — CID 2870942
5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride (PubChem CID 2870942) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride.
| Compound Name | 5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
|---|---|
| PubChem CID | 2870942 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
| SMILES | Cl.c1ccc(C2CNCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H17N.ClH/c1-2-6-13(7-3-1)16-12-17-11-10-14-8-4-5-9-15(14)16;/h1-9,16-17H,10-12H2;1H |
| InChIKey | LZBVNUZIFAKAQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |