C25H33ClFNO2 — CID 2870960
1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol;hydrochloride (PubChem CID 2870960) has the molecular formula C25H33ClFNO2 and a molecular weight of 434.00 g/mol. Its IUPAC name is 1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol;hydrochloride.
| Compound Name | 1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2870960 |
| Molecular Formula | C25H33ClFNO2 |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol;hydrochloride |
| SMILES | Cl.OC(c1ccc(F)cc1)(C1CCCCC1)C(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C25H32FNO2.ClH/c26-23-13-11-22(12-14-23)25(28,21-9-5-2-6-10-21)24(20-7-3-1-4-8-20)19-27-15-17-29-18-16-27;/h1,3-4,7-8,11-14,21,24,28H,2,5-6,9-10,15-19H2;1H |
| InChIKey | PRAGQNDHRXZZJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |