C16H20N2O2 — CID 28712390
(1R)-1-(3-methoxyphenyl)-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 28712390) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 28712390 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | COc1cccc([C@@H](C)NCc2ccc(OC)nc2)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-12(14-5-4-6-15(9-14)19-2)17-10-13-7-8-16(20-3)18-11-13/h4-9,11-12,17H,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | FZRAUCPHFIYOPI-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |