C12H18N2O — CID 28713263
3-(3-aminophenyl)-N-propylpropanamide (PubChem CID 28713263) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-propylpropanamide.
| Compound Name | 3-(3-aminophenyl)-N-propylpropanamide |
|---|---|
| PubChem CID | 28713263 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(3-aminophenyl)-N-propylpropanamide |
| SMILES | CCCNC(=O)CCc1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O/c1-2-8-14-12(15)7-6-10-4-3-5-11(13)9-10/h3-5,9H,2,6-8,13H2,1H3,(H,14,15) |
| InChIKey | BGWVBSKNTZMUOB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|