C14H12N4O — CID 28713579
3-(1,3,4-oxadiazol-2-yl)-N-(pyridin-3-ylmethyl)aniline (PubChem CID 28713579) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-(1,3,4-oxadiazol-2-yl)-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | 3-(1,3,4-oxadiazol-2-yl)-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 28713579 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(1,3,4-oxadiazol-2-yl)-N-(pyridin-3-ylmethyl)aniline |
| SMILES | c1cncc(CNc2cccc(-c3nnco3)c2)c1 |
| InChI | InChI=1S/C14H12N4O/c1-4-12(14-18-17-10-19-14)7-13(5-1)16-9-11-3-2-6-15-8-11/h1-8,10,16H,9H2 |
| InChIKey | SXPJGSPXZDJWAE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |