About 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide
5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide (PubChem CID 28716357) has the molecular formula C11H17FN2O2S
and a molecular weight of 260.33 g/mol. Its IUPAC name is 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide |
| PubChem CID | 28716357 |
| Molecular Formula | C11H17FN2O2S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(CN)ccc1F |
| InChI | InChI=1S/C11H17FN2O2S/c1-3-14(4-2)17(15,16)11-7-9(8-13)5-6-10(11)12/h5-7H,3-4,8,13H2,1-2H3 |
| InChIKey | RIDVERCELKHNLF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide?
The IUPAC name of 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide (CID 28716357) is 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide.
What is the SMILES notation for 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide?
The canonical SMILES for 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide is CCN(CC)S(=O)(=O)c1cc(CN)ccc1F.
What is the InChIKey of 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide?
The InChIKey is RIDVERCELKHNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2O2S/c1-3-14(4-2)17(15,16)11-7-9(8-13)5-6-10(11)12/h5-7H,3-4,8,13H2,1-2H3.
What are the key properties of 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide?
5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide has a molecular weight of 260.33 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N,N-diethyl-2-fluorobenzenesulfonamide is sourced from PubChem (CID 28716357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).